C19H19F3N2O2S — CID 3860254
3-[[4-(dimethylamino)phenyl]methyl]-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidin-4-one (PubChem CID 3860254) has the molecular formula C19H19F3N2O2S and a molecular weight of 396.43 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)phenyl]methyl]-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | 3-[[4-(dimethylamino)phenyl]methyl]-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3860254 |
| Molecular Formula | C19H19F3N2O2S |
| Molecular Weight | 396.43 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 3-[[4-(dimethylamino)phenyl]methyl]-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidin-4-one |
| SMILES | CN(C)c1ccc(CN2C(=O)CSC2c2cccc(OC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C19H19F3N2O2S/c1-23(2)15-8-6-13(7-9-15)11-24-17(25)12-27-18(24)14-4-3-5-16(10-14)26-19(20,21)22/h3-10,18H,11-12H2,1-2H3 |
| InChIKey | LGGLVHJPHZNLPL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|