C21H26N2OS — CID 3684457
3-[[4-(dimethylamino)phenyl]methyl]-2-(2,4,6-trimethylphenyl)-1,3-thiazolidin-4-one (PubChem CID 3684457) has the molecular formula C21H26N2OS and a molecular weight of 354.52 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)phenyl]methyl]-2-(2,4,6-trimethylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-[[4-(dimethylamino)phenyl]methyl]-2-(2,4,6-trimethylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3684457 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 3-[[4-(dimethylamino)phenyl]methyl]-2-(2,4,6-trimethylphenyl)-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C)c(C2SCC(=O)N2Cc2ccc(N(C)C)cc2)c(C)c1 |
| InChI | InChI=1S/C21H26N2OS/c1-14-10-15(2)20(16(3)11-14)21-23(19(24)13-25-21)12-17-6-8-18(9-7-17)22(4)5/h6-11,21H,12-13H2,1-5H3 |
| InChIKey | RLELRXBIVFMFKX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|