C19H18F3NOS — CID 3671440
3-[(3,4,5-trifluorophenyl)methyl]-2-(2,4,6-trimethylphenyl)-1,3-thiazolidin-4-one (PubChem CID 3671440) has the molecular formula C19H18F3NOS and a molecular weight of 365.42 g/mol. Its IUPAC name is 3-[(3,4,5-trifluorophenyl)methyl]-2-(2,4,6-trimethylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-[(3,4,5-trifluorophenyl)methyl]-2-(2,4,6-trimethylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3671440 |
| Molecular Formula | C19H18F3NOS |
| Molecular Weight | 365.42 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 3-[(3,4,5-trifluorophenyl)methyl]-2-(2,4,6-trimethylphenyl)-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C)c(C2SCC(=O)N2Cc2cc(F)c(F)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C19H18F3NOS/c1-10-4-11(2)17(12(3)5-10)19-23(16(24)9-25-19)8-13-6-14(20)18(22)15(21)7-13/h4-7,19H,8-9H2,1-3H3 |
| InChIKey | ZDEYYYYVUKRCCK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|