C16H11F4NOS — CID 3858526
3-[(3-fluorophenyl)methyl]-2-(2,3,4-trifluorophenyl)-1,3-thiazolidin-4-one (PubChem CID 3858526) has the molecular formula C16H11F4NOS and a molecular weight of 341.33 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)methyl]-2-(2,3,4-trifluorophenyl)-1,3-thiazolidin-4-one.
| Compound Name | 3-[(3-fluorophenyl)methyl]-2-(2,3,4-trifluorophenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3858526 |
| Molecular Formula | C16H11F4NOS |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 3-[(3-fluorophenyl)methyl]-2-(2,3,4-trifluorophenyl)-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccc(F)c(F)c2F)N1Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H11F4NOS/c17-10-3-1-2-9(6-10)7-21-13(22)8-23-16(21)11-4-5-12(18)15(20)14(11)19/h1-6,16H,7-8H2 |
| InChIKey | WRCJYGPCMSHCQE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|