C18H18ClFN2OS — CID 4521493
2-[2-chloro-4-(dimethylamino)phenyl]-3-[(3-fluorophenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 4521493) has the molecular formula C18H18ClFN2OS and a molecular weight of 364.87 g/mol. Its IUPAC name is 2-[2-chloro-4-(dimethylamino)phenyl]-3-[(3-fluorophenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-[2-chloro-4-(dimethylamino)phenyl]-3-[(3-fluorophenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4521493 |
| Molecular Formula | C18H18ClFN2OS |
| Molecular Weight | 364.87 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 2-[2-chloro-4-(dimethylamino)phenyl]-3-[(3-fluorophenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | CN(C)c1ccc(C2SCC(=O)N2Cc2cccc(F)c2)c(Cl)c1 |
| InChI | InChI=1S/C18H18ClFN2OS/c1-21(2)14-6-7-15(16(19)9-14)18-22(17(23)11-24-18)10-12-4-3-5-13(20)8-12/h3-9,18H,10-11H2,1-2H3 |
| InChIKey | MCCYFCQAISFSOR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.87 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|