C21H28ClN3O2S2 — CID 3822103
2-[2-chloro-4-(dimethylamino)phenyl]-3-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1,3-thiazolidin-4-one (PubChem CID 3822103) has the molecular formula C21H28ClN3O2S2 and a molecular weight of 454.06 g/mol. Its IUPAC name is 2-[2-chloro-4-(dimethylamino)phenyl]-3-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-[2-chloro-4-(dimethylamino)phenyl]-3-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3822103 |
| Molecular Formula | C21H28ClN3O2S2 |
| Molecular Weight | 454.06 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 2-[2-chloro-4-(dimethylamino)phenyl]-3-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1,3-thiazolidin-4-one |
| SMILES | CN(C)Cc1ccc(CSCCN2C(=O)CSC2c2ccc(N(C)C)cc2Cl)o1 |
| InChI | InChI=1S/C21H28ClN3O2S2/c1-23(2)12-16-6-7-17(27-16)13-28-10-9-25-20(26)14-29-21(25)18-8-5-15(24(3)4)11-19(18)22/h5-8,11,21H,9-10,12-14H2,1-4H3 |
| InChIKey | FWGNMWLXDNEDDA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 39.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.06 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|