C20H21ClN2O3S — CID 23826766
3-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[2-chloro-4-(dimethylamino)phenyl]-1,3-thiazolidin-4-one (PubChem CID 23826766) has the molecular formula C20H21ClN2O3S and a molecular weight of 404.92 g/mol. Its IUPAC name is 3-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[2-chloro-4-(dimethylamino)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | 3-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[2-chloro-4-(dimethylamino)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 23826766 |
| Molecular Formula | C20H21ClN2O3S |
| Molecular Weight | 404.92 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 3-[2-(1,3-benzodioxol-5-yl)ethyl]-2-[2-chloro-4-(dimethylamino)phenyl]-1,3-thiazolidin-4-one |
| SMILES | CN(C)c1ccc(C2SCC(=O)N2CCc2ccc3c(c2)OCO3)c(Cl)c1 |
| InChI | InChI=1S/C20H21ClN2O3S/c1-22(2)14-4-5-15(16(21)10-14)20-23(19(24)11-27-20)8-7-13-3-6-17-18(9-13)26-12-25-17/h3-6,9-10,20H,7-8,11-12H2,1-2H3 |
| InChIKey | JFFMTWBSQJALRY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.92 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|