C17H25IN2O3S — CID 134108977
2-[2-(1,3-benzodioxol-5-yl)-4-oxo-1,3-thiazolidin-3-yl]ethyl-diethyl-methylazanium iodide (PubChem CID 134108977) has the molecular formula C17H25IN2O3S and a molecular weight of 464.37 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)-4-oxo-1,3-thiazolidin-3-yl]ethyl-diethyl-methylazanium iodide.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)-4-oxo-1,3-thiazolidin-3-yl]ethyl-diethyl-methylazanium iodide |
|---|---|
| PubChem CID | 134108977 |
| Molecular Formula | C17H25IN2O3S |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)-4-oxo-1,3-thiazolidin-3-yl]ethyl-diethyl-methylazanium iodide |
| SMILES | CC[N+](C)(CC)CCN1C(=O)CSC1c1ccc2c(c1)OCO2.[I-] |
| InChI | InChI=1S/C17H25N2O3S.HI/c1-4-19(3,5-2)9-8-18-16(20)11-23-17(18)13-6-7-14-15(10-13)22-12-21-14;/h6-7,10,17H,4-5,8-9,11-12H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | GMNOJJUPDMQNND-UHFFFAOYSA-M |
| XLogP | -0.52 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|