C18H22N2O2S — CID 5003539
3-[[4-(dimethylamino)phenyl]methyl]-2-(4,5-dimethylfuran-2-yl)-1,3-thiazolidin-4-one (PubChem CID 5003539) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is 3-[[4-(dimethylamino)phenyl]methyl]-2-(4,5-dimethylfuran-2-yl)-1,3-thiazolidin-4-one.
| Compound Name | 3-[[4-(dimethylamino)phenyl]methyl]-2-(4,5-dimethylfuran-2-yl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5003539 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 3-[[4-(dimethylamino)phenyl]methyl]-2-(4,5-dimethylfuran-2-yl)-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(C2SCC(=O)N2Cc2ccc(N(C)C)cc2)oc1C |
| InChI | InChI=1S/C18H22N2O2S/c1-12-9-16(22-13(12)2)18-20(17(21)11-23-18)10-14-5-7-15(8-6-14)19(3)4/h5-9,18H,10-11H2,1-4H3 |
| InChIKey | SSRDSRJBPFTTFD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|