C17H12F3NO3S — CID 3763893
2-(1,3-benzodioxol-4-yl)-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 3763893) has the molecular formula C17H12F3NO3S and a molecular weight of 367.35 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-4-yl)-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-(1,3-benzodioxol-4-yl)-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3763893 |
| Molecular Formula | C17H12F3NO3S |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 2-(1,3-benzodioxol-4-yl)-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2cccc3c2OCO3)N1Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H12F3NO3S/c18-11-5-4-9(14(19)15(11)20)6-21-13(22)7-25-17(21)10-2-1-3-12-16(10)24-8-23-12/h1-5,17H,6-8H2 |
| InChIKey | YQPVTWHTPWIANU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|