C16H10ClF4NOS — CID 5164631
2-(3-chloro-4-fluorophenyl)-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 5164631) has the molecular formula C16H10ClF4NOS and a molecular weight of 375.77 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 5164631 |
| Molecular Formula | C16H10ClF4NOS |
| Molecular Weight | 375.77 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2ccc(F)c(Cl)c2)N1Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H10ClF4NOS/c17-10-5-8(1-3-11(10)18)16-22(13(23)7-24-16)6-9-2-4-12(19)15(21)14(9)20/h1-5,16H,6-7H2 |
| InChIKey | NITBZYIVMUGNOA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.77 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|