C15H12F3NOS2 — CID 3875123
2-(3-methylthiophen-2-yl)-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-4-one (PubChem CID 3875123) has the molecular formula C15H12F3NOS2 and a molecular weight of 343.40 g/mol. Its IUPAC name is 2-(3-methylthiophen-2-yl)-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-4-one.
| Compound Name | 2-(3-methylthiophen-2-yl)-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3875123 |
| Molecular Formula | C15H12F3NOS2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 2-(3-methylthiophen-2-yl)-3-[(2,3,4-trifluorophenyl)methyl]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccsc1C1SCC(=O)N1Cc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H12F3NOS2/c1-8-4-5-21-14(8)15-19(11(20)7-22-15)6-9-2-3-10(16)13(18)12(9)17/h2-5,15H,6-7H2,1H3 |
| InChIKey | XJTREHZKSAHDBG-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|