C18H20F3NO2S — CID 21103355
3-[2-(cyclohexen-1-yl)ethyl]-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidin-4-one (PubChem CID 21103355) has the molecular formula C18H20F3NO2S and a molecular weight of 371.42 g/mol. Its IUPAC name is 3-[2-(cyclohexen-1-yl)ethyl]-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | 3-[2-(cyclohexen-1-yl)ethyl]-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 21103355 |
| Molecular Formula | C18H20F3NO2S |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 3-[2-(cyclohexen-1-yl)ethyl]-2-[3-(trifluoromethoxy)phenyl]-1,3-thiazolidin-4-one |
| SMILES | O=C1CSC(c2cccc(OC(F)(F)F)c2)N1CCC1=CCCCC1 |
| InChI | InChI=1S/C18H20F3NO2S/c19-18(20,21)24-15-8-4-7-14(11-15)17-22(16(23)12-25-17)10-9-13-5-2-1-3-6-13/h4-5,7-8,11,17H,1-3,6,9-10,12H2 |
| InChIKey | WRCQHYSGMSEZLS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|