C27H50O3S2 — CID 178079224
1,13-bis(cyclohexylmethylsulfanyl)-2,12-dihydroxytridecan-7-one (PubChem CID 178079224) has the molecular formula C27H50O3S2 and a molecular weight of 486.83 g/mol. Its IUPAC name is 1,13-bis(cyclohexylmethylsulfanyl)-2,12-dihydroxytridecan-7-one.
| Compound Name | 1,13-bis(cyclohexylmethylsulfanyl)-2,12-dihydroxytridecan-7-one |
|---|---|
| PubChem CID | 178079224 |
| Molecular Formula | C27H50O3S2 |
| Molecular Weight | 486.83 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | 1,13-bis(cyclohexylmethylsulfanyl)-2,12-dihydroxytridecan-7-one |
| SMILES | O=C(CCCCC(O)CSCC1CCCCC1)CCCCC(O)CSCC1CCCCC1 |
| InChI | InChI=1S/C27H50O3S2/c28-25(15-7-9-17-26(29)21-31-19-23-11-3-1-4-12-23)16-8-10-18-27(30)22-32-20-24-13-5-2-6-14-24/h23-24,26-27,29-30H,1-22H2 |
| InChIKey | QJIXHXIECJHBPJ-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.83 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|