C26H39FN4O4 — CID 178082732
1-fluoro-3-methoxybenzene;N-[3-(methylamino)propyl]-4-[(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide;propane (PubChem CID 178082732) has the molecular formula C26H39FN4O4 and a molecular weight of 490.62 g/mol. Its IUPAC name is 1-fluoro-3-methoxybenzene;N-[3-(methylamino)propyl]-4-[(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide;propane.
| Compound Name | 1-fluoro-3-methoxybenzene;N-[3-(methylamino)propyl]-4-[(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide;propane |
|---|---|
| PubChem CID | 178082732 |
| Molecular Formula | C26H39FN4O4 |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.30 |
| IUPAC Name | 1-fluoro-3-methoxybenzene;N-[3-(methylamino)propyl]-4-[(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide;propane |
| SMILES | CCC.CNCCCNC(=O)c1cc(NC(=O)C2CCC(C)O2)ccn1.COc1cccc(F)c1 |
| InChI | InChI=1S/C16H24N4O3.C7H7FO.C3H8/c1-11-4-5-14(23-11)16(22)20-12-6-9-18-13(10-12)15(21)19-8-3-7-17-2;1-9-7-4-2-3-6(8)5-7;1-3-2/h6,9-11,14,17H,3-5,7-8H2,1-2H3,(H,19,21)(H,18,20,22);2-5H,1H3;3H2,1-2H3 |
| InChIKey | OQWYDVNZHILILP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 101.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|