C19H22FN3O3 — CID 178083049
1-fluoro-3-methylbenzene;4-[(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide (PubChem CID 178083049) has the molecular formula C19H22FN3O3 and a molecular weight of 359.40 g/mol. Its IUPAC name is 1-fluoro-3-methylbenzene;4-[(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide.
| Compound Name | 1-fluoro-3-methylbenzene;4-[(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 178083049 |
| Molecular Formula | C19H22FN3O3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 1-fluoro-3-methylbenzene;4-[(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide |
| SMILES | CC1CCC(C(=O)Nc2ccnc(C(N)=O)c2)O1.Cc1cccc(F)c1 |
| InChI | InChI=1S/C12H15N3O3.C7H7F/c1-7-2-3-10(18-7)12(17)15-8-4-5-14-9(6-8)11(13)16;1-6-3-2-4-7(8)5-6/h4-7,10H,2-3H2,1H3,(H2,13,16)(H,14,15,17);2-5H,1H3 |
| InChIKey | DBYWMBOGHVZURN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |