About 4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide
4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide (PubChem CID 156750138) has the molecular formula C13H17N3O3
and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide.
Molecular Properties
| Compound Name | 4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide |
| PubChem CID | 156750138 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide |
| SMILES | CC1CC(C(=O)Nc2ccnc(C(N)=O)c2)OC1C |
| InChI | InChI=1S/C13H17N3O3/c1-7-5-11(19-8(7)2)13(18)16-9-3-4-15-10(6-9)12(14)17/h3-4,6-8,11H,5H2,1-2H3,(H2,14,17)(H,15,16,18) |
| InChIKey | LOHIUUYXRIXHKR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide?
The IUPAC name of 4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide (CID 156750138) is 4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide.
What is the SMILES notation for 4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide?
The canonical SMILES for 4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide is CC1CC(C(=O)Nc2ccnc(C(N)=O)c2)OC1C.
What is the InChIKey of 4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide?
The InChIKey is LOHIUUYXRIXHKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O3/c1-7-5-11(19-8(7)2)13(18)16-9-3-4-15-10(6-9)12(14)17/h3-4,6-8,11H,5H2,1-2H3,(H2,14,17)(H,15,16,18).
What are the key properties of 4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide?
4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide has a molecular weight of 263.30 g/mol, XLogP of 0.93, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide is sourced from PubChem (CID 156750138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).