C13H17N3O3 — CID 156750138
4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide (PubChem CID 156750138) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide.
| Compound Name | 4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 156750138 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 4-[(4,5-dimethyloxolane-2-carbonyl)amino]pyridine-2-carboxamide |
| SMILES | CC1CC(C(=O)Nc2ccnc(C(N)=O)c2)OC1C |
| InChI | InChI=1S/C13H17N3O3/c1-7-5-11(19-8(7)2)13(18)16-9-3-4-15-10(6-9)12(14)17/h3-4,6-8,11H,5H2,1-2H3,(H2,14,17)(H,15,16,18) |
| InChIKey | LOHIUUYXRIXHKR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |