C24H33FN4O4 — CID 178082658
3-(2-fluorophenoxy)-N-propan-2-ylpropan-1-amine;4-[(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide (PubChem CID 178082658) has the molecular formula C24H33FN4O4 and a molecular weight of 460.55 g/mol. Its IUPAC name is 3-(2-fluorophenoxy)-N-propan-2-ylpropan-1-amine;4-[(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide.
| Compound Name | 3-(2-fluorophenoxy)-N-propan-2-ylpropan-1-amine;4-[(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 178082658 |
| Molecular Formula | C24H33FN4O4 |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | 3-(2-fluorophenoxy)-N-propan-2-ylpropan-1-amine;4-[(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide |
| SMILES | CC(C)NCCCOc1ccccc1F.CC1CCC(C(=O)Nc2ccnc(C(N)=O)c2)O1 |
| InChI | InChI=1S/C12H18FNO.C12H15N3O3/c1-10(2)14-8-5-9-15-12-7-4-3-6-11(12)13;1-7-2-3-10(18-7)12(17)15-8-4-5-14-9(6-8)11(13)16/h3-4,6-7,10,14H,5,8-9H2,1-2H3;4-7,10H,2-3H2,1H3,(H2,13,16)(H,14,15,17) |
| InChIKey | DIMYCNRHDVSICF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|