C22H25F3N4O5 — CID 166159319
4-[(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide;(NE)-N-[1-[2-(trifluoromethyl)phenoxy]propan-2-ylidene]hydroxylamine (PubChem CID 166159319) has the molecular formula C22H25F3N4O5 and a molecular weight of 482.46 g/mol. Its IUPAC name is 4-[(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide;(NE)-N-[1-[2-(trifluoromethyl)phenoxy]propan-2-ylidene]hydroxylamine.
| Compound Name | 4-[(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide;(NE)-N-[1-[2-(trifluoromethyl)phenoxy]propan-2-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 166159319 |
| Molecular Formula | C22H25F3N4O5 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 4-[(5-methyloxolane-2-carbonyl)amino]pyridine-2-carboxamide;(NE)-N-[1-[2-(trifluoromethyl)phenoxy]propan-2-ylidene]hydroxylamine |
| SMILES | C/C(COc1ccccc1C(F)(F)F)=N\O.CC1CCC(C(=O)Nc2ccnc(C(N)=O)c2)O1 |
| InChI | InChI=1S/C12H15N3O3.C10H10F3NO2/c1-7-2-3-10(18-7)12(17)15-8-4-5-14-9(6-8)11(13)16;1-7(14-15)6-16-9-5-3-2-4-8(9)10(11,12)13/h4-7,10H,2-3H2,1H3,(H2,13,16)(H,14,15,17);2-5,15H,6H2,1H3/b;14-7+ |
| InChIKey | JOZIMTIGJDISTP-HDUMEGEHSA-N |
| XLogP | 3.62 |
| TPSA | 136.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|