C24H30N2O4 — CID 178084001
tert-butyl 5-[4-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxycarbonylamino]phenyl]-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 178084001) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is tert-butyl 5-[4-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxycarbonylamino]phenyl]-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 5-[4-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxycarbonylamino]phenyl]-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 178084001 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | tert-butyl 5-[4-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxycarbonylamino]phenyl]-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C=C/C(=C\C=C/C)OC(=O)Nc1ccc(C2=CN(C(=O)OC(C)(C)C)CCC2)cc1 |
| InChI | InChI=1S/C24H30N2O4/c1-6-8-11-21(7-2)29-22(27)25-20-14-12-18(13-15-20)19-10-9-16-26(17-19)23(28)30-24(3,4)5/h6-8,11-15,17H,2,9-10,16H2,1,3-5H3,(H,25,27)/b8-6-,21-11+ |
| InChIKey | NNFJFOLKXGRWAX-DDXVOHCGSA-N |
| XLogP | 6.25 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|