C18H22N2O5 — CID 166390345
tert-butyl 6-[(E)-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1,4-oxazine-4-carboxylate (PubChem CID 166390345) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is tert-butyl 6-[(E)-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1,4-oxazine-4-carboxylate.
| Compound Name | tert-butyl 6-[(E)-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1,4-oxazine-4-carboxylate |
|---|---|
| PubChem CID | 166390345 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | tert-butyl 6-[(E)-3-(4-hydroxyanilino)-3-oxoprop-1-enyl]-2,3-dihydro-1,4-oxazine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C=C(/C=C/C(=O)Nc2ccc(O)cc2)OCC1 |
| InChI | InChI=1S/C18H22N2O5/c1-18(2,3)25-17(23)20-10-11-24-15(12-20)8-9-16(22)19-13-4-6-14(21)7-5-13/h4-9,12,21H,10-11H2,1-3H3,(H,19,22)/b9-8+ |
| InChIKey | CWRDXGFLXGLHOM-CMDGGOBGSA-N |
| XLogP | 3.00 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|