C19H24F3N3O5S — CID 56954505
tert-butyl 4-[4-[[(E)-4,4,4-trifluorobut-2-enoyl]amino]phenyl]sulfonylpiperazine-1-carboxylate (PubChem CID 56954505) has the molecular formula C19H24F3N3O5S and a molecular weight of 463.48 g/mol. Its IUPAC name is tert-butyl 4-[4-[[(E)-4,4,4-trifluorobut-2-enoyl]amino]phenyl]sulfonylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[[(E)-4,4,4-trifluorobut-2-enoyl]amino]phenyl]sulfonylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 56954505 |
| Molecular Formula | C19H24F3N3O5S |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | tert-butyl 4-[4-[[(E)-4,4,4-trifluorobut-2-enoyl]amino]phenyl]sulfonylpiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(S(=O)(=O)c2ccc(NC(=O)/C=C/C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H24F3N3O5S/c1-18(2,3)30-17(27)24-10-12-25(13-11-24)31(28,29)15-6-4-14(5-7-15)23-16(26)8-9-19(20,21)22/h4-9H,10-13H2,1-3H3,(H,23,26)/b9-8+ |
| InChIKey | BVDRJBVWBLMQLN-CMDGGOBGSA-N |
| XLogP | 2.98 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|