C30H35BF4N4O4 — CID 178084964
(5R,7S)-2-[2-cyclopropyl-6-(trifluoromethyl)-3-pyridinyl]-8-[3-fluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-7-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one (PubChem CID 178084964) has the molecular formula C30H35BF4N4O4 and a molecular weight of 602.44 g/mol. Its IUPAC name is (5R,7S)-2-[2-cyclopropyl-6-(trifluoromethyl)-3-pyridinyl]-8-[3-fluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-7-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one.
| Compound Name | (5R,7S)-2-[2-cyclopropyl-6-(trifluoromethyl)-3-pyridinyl]-8-[3-fluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-7-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
|---|---|
| PubChem CID | 178084964 |
| Molecular Formula | C30H35BF4N4O4 |
| Molecular Weight | 602.44 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | (5R,7S)-2-[2-cyclopropyl-6-(trifluoromethyl)-3-pyridinyl]-8-[3-fluoro-2-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-7-methyl-1,3,8-triazaspiro[4.5]dec-1-en-4-one |
| SMILES | COc1c(F)cc(B2OC(C)(C)C(C)(C)O2)cc1N1CC[C@]2(C[C@@H]1C)N=C(c1ccc(C(F)(F)F)nc1C1CC1)NC2=O |
| InChI | InChI=1S/C30H35BF4N4O4/c1-16-15-29(26(40)37-25(38-29)19-9-10-22(30(33,34)35)36-23(19)17-7-8-17)11-12-39(16)21-14-18(13-20(32)24(21)41-6)31-42-27(2,3)28(4,5)43-31/h9-10,13-14,16-17H,7-8,11-12,15H2,1-6H3,(H,37,38,40)/t16-,29+/m0/s1 |
| InChIKey | LFNVDJUHQWWDRW-GUNSETOZSA-N |
| XLogP | 4.73 |
| TPSA | 85.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.44 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|