C26H33N7OS — CID 178085991
2-amino-4-[3-[4-(2,4-dimethyl-1,4-diazepan-1-yl)pyrimidin-2-yl]-4-propyl-1,2-oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 178085991) has the molecular formula C26H33N7OS and a molecular weight of 491.67 g/mol. Its IUPAC name is 2-amino-4-[3-[4-(2,4-dimethyl-1,4-diazepan-1-yl)pyrimidin-2-yl]-4-propyl-1,2-oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-amino-4-[3-[4-(2,4-dimethyl-1,4-diazepan-1-yl)pyrimidin-2-yl]-4-propyl-1,2-oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 178085991 |
| Molecular Formula | C26H33N7OS |
| Molecular Weight | 491.67 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | 2-amino-4-[3-[4-(2,4-dimethyl-1,4-diazepan-1-yl)pyrimidin-2-yl]-4-propyl-1,2-oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | CCCc1c(-c2nccc(N3CCCN(C)CC3C)n2)noc1C1CCCc2sc(N)c(C#N)c21 |
| InChI | InChI=1S/C26H33N7OS/c1-4-7-18-23(26-29-11-10-21(30-26)33-13-6-12-32(3)15-16(33)2)31-34-24(18)17-8-5-9-20-22(17)19(14-27)25(28)35-20/h10-11,16-17H,4-9,12-13,15,28H2,1-3H3 |
| InChIKey | RTDVUGMAELZDEU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 108.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.67 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |