C24H29N7OS — CID 168910302
2-amino-4-[3-[2-(1,4-diazepan-1-yl)pyrimidin-4-yl]-4-propyl-1,2-oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile (PubChem CID 168910302) has the molecular formula C24H29N7OS and a molecular weight of 463.61 g/mol. Its IUPAC name is 2-amino-4-[3-[2-(1,4-diazepan-1-yl)pyrimidin-4-yl]-4-propyl-1,2-oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile.
| Compound Name | 2-amino-4-[3-[2-(1,4-diazepan-1-yl)pyrimidin-4-yl]-4-propyl-1,2-oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 168910302 |
| Molecular Formula | C24H29N7OS |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 2-amino-4-[3-[2-(1,4-diazepan-1-yl)pyrimidin-4-yl]-4-propyl-1,2-oxazol-5-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
| SMILES | CCCc1c(-c2ccnc(N3CCCNCC3)n2)noc1C1CCCc2sc(N)c(C#N)c21 |
| InChI | InChI=1S/C24H29N7OS/c1-2-5-16-21(18-8-10-28-24(29-18)31-12-4-9-27-11-13-31)30-32-22(16)15-6-3-7-19-20(15)17(14-25)23(26)33-19/h8,10,15,27H,2-7,9,11-13,26H2,1H3 |
| InChIKey | BBTNJZFUQAMKTE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 116.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |