C12H17N5O4 — CID 178090277
2-[4-[(3R)-3-hydroxypyrrolidin-1-yl]-2-methoxy-5-nitrophenyl]guanidine (PubChem CID 178090277) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-[4-[(3R)-3-hydroxypyrrolidin-1-yl]-2-methoxy-5-nitrophenyl]guanidine.
| Compound Name | 2-[4-[(3R)-3-hydroxypyrrolidin-1-yl]-2-methoxy-5-nitrophenyl]guanidine |
|---|---|
| PubChem CID | 178090277 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2-[4-[(3R)-3-hydroxypyrrolidin-1-yl]-2-methoxy-5-nitrophenyl]guanidine |
| SMILES | COc1cc(N2CC[C@@H](O)C2)c([N+](=O)[O-])cc1N=C(N)N |
| InChI | InChI=1S/C12H17N5O4/c1-21-11-5-9(16-3-2-7(18)6-16)10(17(19)20)4-8(11)15-12(13)14/h4-5,7,18H,2-3,6H2,1H3,(H4,13,14,15)/t7-/m1/s1 |
| InChIKey | PXOIANTZQCOQBA-SSDOTTSWSA-N |
| XLogP | 0.08 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|