C20H39N4O6+ — CID 178091240
[6-[[(2R)-2-carboxy-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethyl]amino]-6-oxohexyl]-trimethylazanium (PubChem CID 178091240) has the molecular formula C20H39N4O6+ and a molecular weight of 431.55 g/mol. Its IUPAC name is [6-[[(2R)-2-carboxy-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethyl]amino]-6-oxohexyl]-trimethylazanium.
| Compound Name | [6-[[(2R)-2-carboxy-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethyl]amino]-6-oxohexyl]-trimethylazanium |
|---|---|
| PubChem CID | 178091240 |
| Molecular Formula | C20H39N4O6+ |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | [6-[[(2R)-2-carboxy-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]amino]ethyl]amino]-6-oxohexyl]-trimethylazanium |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@H](CNC(=O)CCCCC[N+](C)(C)C)C(=O)O |
| InChI | InChI=1S/C20H38N4O6/c1-14(22-19(29)30-20(2,3)4)17(26)23-15(18(27)28)13-21-16(25)11-9-8-10-12-24(5,6)7/h14-15H,8-13H2,1-7H3,(H3-,21,22,23,25,26,27,28,29)/p+1/t14-,15+/m0/s1 |
| InChIKey | CUVJRVZJKPKCEY-LSDHHAIUSA-O |
| XLogP | 0.85 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|