C23H23F2IN5O3P — CID 178095247
[6-[(E,3E)-1-amino-3-iodophosphanyliminoprop-1-en-2-yl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-[3-[3-(difluoromethoxy)phenyl]morpholin-4-yl]methanone (PubChem CID 178095247) has the molecular formula C23H23F2IN5O3P and a molecular weight of 613.34 g/mol. Its IUPAC name is [6-[(E,3E)-1-amino-3-iodophosphanyliminoprop-1-en-2-yl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-[3-[3-(difluoromethoxy)phenyl]morpholin-4-yl]methanone.
| Compound Name | [6-[(E,3E)-1-amino-3-iodophosphanyliminoprop-1-en-2-yl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-[3-[3-(difluoromethoxy)phenyl]morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 178095247 |
| Molecular Formula | C23H23F2IN5O3P |
| Molecular Weight | 613.34 g/mol |
| Exact Mass | 613.06 |
| IUPAC Name | [6-[(E,3E)-1-amino-3-iodophosphanyliminoprop-1-en-2-yl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-[3-[3-(difluoromethoxy)phenyl]morpholin-4-yl]methanone |
| SMILES | Cn1cc(C(=O)N2CCOCC2c2cccc(OC(F)F)c2)c2ccc(C(=C/N)/C=N/PI)nc21 |
| InChI | InChI=1S/C23H23F2IN5O3P/c1-30-12-18(17-5-6-19(29-21(17)30)15(10-27)11-28-35-26)22(32)31-7-8-33-13-20(31)14-3-2-4-16(9-14)34-23(24)25/h2-6,9-12,20,23,35H,7-8,13,27H2,1H3/b15-10+,28-11+ |
| InChIKey | GTPKLORYOBBIHJ-NUPBQMFQSA-N |
| XLogP | 4.70 |
| TPSA | 94.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.34 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|