C19H18ClN3O3 — CID 178094981
(6-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-[(3S)-3-(3-methoxyphenyl)morpholin-4-yl]methanone (PubChem CID 178094981) has the molecular formula C19H18ClN3O3 and a molecular weight of 371.82 g/mol. Its IUPAC name is (6-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-[(3S)-3-(3-methoxyphenyl)morpholin-4-yl]methanone.
| Compound Name | (6-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-[(3S)-3-(3-methoxyphenyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 178094981 |
| Molecular Formula | C19H18ClN3O3 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | (6-chloro-1H-pyrrolo[2,3-b]pyridin-2-yl)-[(3S)-3-(3-methoxyphenyl)morpholin-4-yl]methanone |
| SMILES | COc1cccc([C@H]2COCCN2C(=O)c2cc3ccc(Cl)nc3[nH]2)c1 |
| InChI | InChI=1S/C19H18ClN3O3/c1-25-14-4-2-3-12(9-14)16-11-26-8-7-23(16)19(24)15-10-13-5-6-17(20)22-18(13)21-15/h2-6,9-10,16H,7-8,11H2,1H3,(H,21,22)/t16-/m1/s1 |
| InChIKey | ZAPSCCAFCNRCHD-MRXNPFEDSA-N |
| XLogP | 3.44 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|