C19H14ClF2N3O4 — CID 178095306
(6-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-[(3S)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)morpholin-4-yl]methanone (PubChem CID 178095306) has the molecular formula C19H14ClF2N3O4 and a molecular weight of 421.79 g/mol. Its IUPAC name is (6-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-[(3S)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)morpholin-4-yl]methanone.
| Compound Name | (6-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-[(3S)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 178095306 |
| Molecular Formula | C19H14ClF2N3O4 |
| Molecular Weight | 421.79 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | (6-chloro-1H-pyrrolo[2,3-b]pyridin-3-yl)-[(3S)-3-(2,2-difluoro-1,3-benzodioxol-5-yl)morpholin-4-yl]methanone |
| SMILES | O=C(c1c[nH]c2nc(Cl)ccc12)N1CCOC[C@@H]1c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C19H14ClF2N3O4/c20-16-4-2-11-12(8-23-17(11)24-16)18(26)25-5-6-27-9-13(25)10-1-3-14-15(7-10)29-19(21,22)28-14/h1-4,7-8,13H,5-6,9H2,(H,23,24)/t13-/m1/s1 |
| InChIKey | IKMRINXXZJUFDV-CYBMUJFWSA-N |
| XLogP | 3.75 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.79 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|