About ethane;[3-(hydroxymethyl)-1-methylpyrrolidin-3-yl]methanol;1-methylpyrrolidine
ethane;[3-(hydroxymethyl)-1-methylpyrrolidin-3-yl]methanol;1-methylpyrrolidine (PubChem CID 178098213) has the molecular formula C14H32N2O2
and a molecular weight of 260.42 g/mol. Its IUPAC name is ethane;[3-(hydroxymethyl)-1-methylpyrrolidin-3-yl]methanol;1-methylpyrrolidine.
Molecular Properties
| Compound Name | ethane;[3-(hydroxymethyl)-1-methylpyrrolidin-3-yl]methanol;1-methylpyrrolidine |
| PubChem CID | 178098213 |
| Molecular Formula | C14H32N2O2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | ethane;[3-(hydroxymethyl)-1-methylpyrrolidin-3-yl]methanol;1-methylpyrrolidine |
| SMILES | CC.CN1CCC(CO)(CO)C1.CN1CCCC1 |
| InChI | InChI=1S/C7H15NO2.C5H11N.C2H6/c1-8-3-2-7(4-8,5-9)6-10;1-6-4-2-3-5-6;1-2/h9-10H,2-6H2,1H3;2-5H2,1H3;1-2H3 |
| InChIKey | LKOJZZAYNJTLFI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;[3-(hydroxymethyl)-1-methylpyrrolidin-3-yl]methanol;1-methylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[3-(hydroxymethyl)-1-methylpyrrolidin-3-yl]methanol;1-methylpyrrolidine?
The IUPAC name of ethane;[3-(hydroxymethyl)-1-methylpyrrolidin-3-yl]methanol;1-methylpyrrolidine (CID 178098213) is ethane;[3-(hydroxymethyl)-1-methylpyrrolidin-3-yl]methanol;1-methylpyrrolidine.
What is the SMILES notation for ethane;[3-(hydroxymethyl)-1-methylpyrrolidin-3-yl]methanol;1-methylpyrrolidine?
The canonical SMILES for ethane;[3-(hydroxymethyl)-1-methylpyrrolidin-3-yl]methanol;1-methylpyrrolidine is CC.CN1CCC(CO)(CO)C1.CN1CCCC1.
What is the InChIKey of ethane;[3-(hydroxymethyl)-1-methylpyrrolidin-3-yl]methanol;1-methylpyrrolidine?
The InChIKey is LKOJZZAYNJTLFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.C5H11N.C2H6/c1-8-3-2-7(4-8,5-9)6-10;1-6-4-2-3-5-6;1-2/h9-10H,2-6H2,1H3;2-5H2,1H3;1-2H3.
What are the key properties of ethane;[3-(hydroxymethyl)-1-methylpyrrolidin-3-yl]methanol;1-methylpyrrolidine?
ethane;[3-(hydroxymethyl)-1-methylpyrrolidin-3-yl]methanol;1-methylpyrrolidine has a molecular weight of 260.42 g/mol, XLogP of 1.03, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[3-(hydroxymethyl)-1-methylpyrrolidin-3-yl]methanol;1-methylpyrrolidine is sourced from PubChem (CID 178098213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).