C10H20N2O2 — CID 164680698
(3aR,6aR)-2,3a,5,6a-tetramethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-3,6-diol (PubChem CID 164680698) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (3aR,6aR)-2,3a,5,6a-tetramethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-3,6-diol.
| Compound Name | (3aR,6aR)-2,3a,5,6a-tetramethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-3,6-diol |
|---|---|
| PubChem CID | 164680698 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | (3aR,6aR)-2,3a,5,6a-tetramethyl-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrole-3,6-diol |
| SMILES | CN1C[C@]2(C)C(O)N(C)C[C@]2(C)C1O |
| InChI | InChI=1S/C10H20N2O2/c1-9-5-11(3)8(14)10(9,2)6-12(4)7(9)13/h7-8,13-14H,5-6H2,1-4H3/t7?,8?,9-,10-/m1/s1 |
| InChIKey | DWIRHMLJKKKXOR-YDYPAMBWSA-N |
| XLogP | -0.47 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |