C15H32N2O — CID 178038334
ethane;methane;[1-[(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]cyclopropyl]methanol (PubChem CID 178038334) has the molecular formula C15H32N2O and a molecular weight of 256.43 g/mol. Its IUPAC name is ethane;methane;[1-[(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]cyclopropyl]methanol.
| Compound Name | ethane;methane;[1-[(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]cyclopropyl]methanol |
|---|---|
| PubChem CID | 178038334 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | ethane;methane;[1-[(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)methyl]cyclopropyl]methanol |
| SMILES | C.CC.CN1CC2CN(CC3(CO)CC3)CC2C1 |
| InChI | InChI=1S/C12H22N2O.C2H6.CH4/c1-13-4-10-6-14(7-11(10)5-13)8-12(9-15)2-3-12;1-2;/h10-11,15H,2-9H2,1H3;1-2H3;1H4 |
| InChIKey | TYDUNAPWGJRAFJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |