C11H23N2O2S2+ — CID 91330720
3a,6a-bis(methoxymethyl)-5-methyl-2,5-bis(sulfanyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-ium (PubChem CID 91330720) has the molecular formula C11H23N2O2S2+ and a molecular weight of 279.45 g/mol. Its IUPAC name is 3a,6a-bis(methoxymethyl)-5-methyl-2,5-bis(sulfanyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-ium.
| Compound Name | 3a,6a-bis(methoxymethyl)-5-methyl-2,5-bis(sulfanyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-ium |
|---|---|
| PubChem CID | 91330720 |
| Molecular Formula | C11H23N2O2S2+ |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3a,6a-bis(methoxymethyl)-5-methyl-2,5-bis(sulfanyl)-1,3,4,6-tetrahydropyrrolo[3,4-c]pyrrol-5-ium |
| SMILES | COCC12CN(S)CC1(COC)C[N+](C)(S)C2 |
| InChI | InChI=1S/C11H23N2O2S2/c1-13(17)6-10(8-14-2)4-12(16)5-11(10,7-13)9-15-3/h16-17H,4-9H2,1-3H3/q+1 |
| InChIKey | UVEBBNCMQCGGBF-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 21.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|