C8H16N2O — CID 129415852
[(3aR,6aS)-5-methyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol (PubChem CID 129415852) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is [(3aR,6aS)-5-methyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol.
| Compound Name | [(3aR,6aS)-5-methyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol |
|---|---|
| PubChem CID | 129415852 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | [(3aR,6aS)-5-methyl-1,2,3,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-3a-yl]methanol |
| SMILES | CN1C[C@@H]2CNC[C@@]2(CO)C1 |
| InChI | InChI=1S/C8H16N2O/c1-10-3-7-2-9-4-8(7,5-10)6-11/h7,9,11H,2-6H2,1H3/t7-,8-/m0/s1 |
| InChIKey | SUJPKUUEKOHKEE-YUMQZZPRSA-N |
| XLogP | -0.87 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |