C17H27N3O4 — CID 178099214
tert-butyl 4-[1-(2-methoxyethyl)-2-oxo-3-pyridinyl]piperazine-1-carboxylate (PubChem CID 178099214) has the molecular formula C17H27N3O4 and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl 4-[1-(2-methoxyethyl)-2-oxo-3-pyridinyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(2-methoxyethyl)-2-oxo-3-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 178099214 |
| Molecular Formula | C17H27N3O4 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | tert-butyl 4-[1-(2-methoxyethyl)-2-oxo-3-pyridinyl]piperazine-1-carboxylate |
| SMILES | COCCn1cccc(N2CCN(C(=O)OC(C)(C)C)CC2)c1=O |
| InChI | InChI=1S/C17H27N3O4/c1-17(2,3)24-16(22)20-10-8-18(9-11-20)14-6-5-7-19(15(14)21)12-13-23-4/h5-7H,8-13H2,1-4H3 |
| InChIKey | NCNLFKOUVLIBOV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |