About ethane;methanol;1-(4-methoxyphenyl)cyclopropane-1-carbaldehyde
ethane;methanol;1-(4-methoxyphenyl)cyclopropane-1-carbaldehyde (PubChem CID 178099838) has the molecular formula C14H22O3
and a molecular weight of 238.33 g/mol. Its IUPAC name is ethane;methanol;1-(4-methoxyphenyl)cyclopropane-1-carbaldehyde.
Molecular Properties
| Compound Name | ethane;methanol;1-(4-methoxyphenyl)cyclopropane-1-carbaldehyde |
| PubChem CID | 178099838 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | ethane;methanol;1-(4-methoxyphenyl)cyclopropane-1-carbaldehyde |
| SMILES | CC.CO.COc1ccc(C2(C=O)CC2)cc1 |
| InChI | InChI=1S/C11H12O2.C2H6.CH4O/c1-13-10-4-2-9(3-5-10)11(8-12)6-7-11;2*1-2/h2-5,8H,6-7H2,1H3;1-2H3;2H,1H3 |
| InChIKey | NSSBDWNPOZOVDD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;methanol;1-(4-methoxyphenyl)cyclopropane-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanol;1-(4-methoxyphenyl)cyclopropane-1-carbaldehyde?
The IUPAC name of ethane;methanol;1-(4-methoxyphenyl)cyclopropane-1-carbaldehyde (CID 178099838) is ethane;methanol;1-(4-methoxyphenyl)cyclopropane-1-carbaldehyde.
What is the SMILES notation for ethane;methanol;1-(4-methoxyphenyl)cyclopropane-1-carbaldehyde?
The canonical SMILES for ethane;methanol;1-(4-methoxyphenyl)cyclopropane-1-carbaldehyde is CC.CO.COc1ccc(C2(C=O)CC2)cc1.
What is the InChIKey of ethane;methanol;1-(4-methoxyphenyl)cyclopropane-1-carbaldehyde?
The InChIKey is NSSBDWNPOZOVDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2.C2H6.CH4O/c1-13-10-4-2-9(3-5-10)11(8-12)6-7-11;2*1-2/h2-5,8H,6-7H2,1H3;1-2H3;2H,1H3.
What are the key properties of ethane;methanol;1-(4-methoxyphenyl)cyclopropane-1-carbaldehyde?
ethane;methanol;1-(4-methoxyphenyl)cyclopropane-1-carbaldehyde has a molecular weight of 238.33 g/mol, XLogP of 2.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanol;1-(4-methoxyphenyl)cyclopropane-1-carbaldehyde is sourced from PubChem (CID 178099838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).