C21H31N5 — CID 178100294
5-N-methyl-2-pentyl-4-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyrimidine-4,5-diamine (PubChem CID 178100294) has the molecular formula C21H31N5 and a molecular weight of 353.51 g/mol. Its IUPAC name is 5-N-methyl-2-pentyl-4-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyrimidine-4,5-diamine.
| Compound Name | 5-N-methyl-2-pentyl-4-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 178100294 |
| Molecular Formula | C21H31N5 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 5-N-methyl-2-pentyl-4-N-[(4-pyrrolidin-1-ylphenyl)methyl]pyrimidine-4,5-diamine |
| SMILES | CCCCCc1ncc(NC)c(NCc2ccc(N3CCCC3)cc2)n1 |
| InChI | InChI=1S/C21H31N5/c1-3-4-5-8-20-23-16-19(22-2)21(25-20)24-15-17-9-11-18(12-10-17)26-13-6-7-14-26/h9-12,16,22H,3-8,13-15H2,1-2H3,(H,23,24,25) |
| InChIKey | NKBTUPURVAPNOA-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|