C17H22N4OS — CID 159240241
4-(benzylamino)-N-hydroxy-2-pentylpyrimidine-5-carbothioamide (PubChem CID 159240241) has the molecular formula C17H22N4OS and a molecular weight of 330.46 g/mol. Its IUPAC name is 4-(benzylamino)-N-hydroxy-2-pentylpyrimidine-5-carbothioamide.
| Compound Name | 4-(benzylamino)-N-hydroxy-2-pentylpyrimidine-5-carbothioamide |
|---|---|
| PubChem CID | 159240241 |
| Molecular Formula | C17H22N4OS |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 4-(benzylamino)-N-hydroxy-2-pentylpyrimidine-5-carbothioamide |
| SMILES | CCCCCc1ncc(C(=S)NO)c(NCc2ccccc2)n1 |
| InChI | InChI=1S/C17H22N4OS/c1-2-3-5-10-15-18-12-14(17(23)21-22)16(20-15)19-11-13-8-6-4-7-9-13/h4,6-9,12,22H,2-3,5,10-11H2,1H3,(H,21,23)(H,18,19,20) |
| InChIKey | KTZNIILJYNKZAU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|