C23H25N7O — CID 15657933
[2-butyl-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]pyrimidin-5-yl]methanol (PubChem CID 15657933) has the molecular formula C23H25N7O and a molecular weight of 415.50 g/mol. Its IUPAC name is [2-butyl-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]pyrimidin-5-yl]methanol.
| Compound Name | [2-butyl-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]pyrimidin-5-yl]methanol |
|---|---|
| PubChem CID | 15657933 |
| Molecular Formula | C23H25N7O |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | [2-butyl-4-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methylamino]pyrimidin-5-yl]methanol |
| SMILES | CCCCc1ncc(CO)c(NCc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)n1 |
| InChI | InChI=1S/C23H25N7O/c1-2-3-8-21-24-14-18(15-31)22(26-21)25-13-16-9-11-17(12-10-16)19-6-4-5-7-20(19)23-27-29-30-28-23/h4-7,9-12,14,31H,2-3,8,13,15H2,1H3,(H,24,25,26)(H,27,28,29,30) |
| InChIKey | KPARIZWCATXKIK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |