C22H23N7O — CID 67751599
[4-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methylamino]-2-propylpyrimidin-5-yl]methanol (PubChem CID 67751599) has the molecular formula C22H23N7O and a molecular weight of 401.47 g/mol. Its IUPAC name is [4-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methylamino]-2-propylpyrimidin-5-yl]methanol.
| Compound Name | [4-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methylamino]-2-propylpyrimidin-5-yl]methanol |
|---|---|
| PubChem CID | 67751599 |
| Molecular Formula | C22H23N7O |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | [4-[[4-phenyl-3-(2H-tetrazol-5-yl)phenyl]methylamino]-2-propylpyrimidin-5-yl]methanol |
| SMILES | CCCc1ncc(CO)c(NCc2ccc(-c3ccccc3)c(-c3nn[nH]n3)c2)n1 |
| InChI | InChI=1S/C22H23N7O/c1-2-6-20-23-13-17(14-30)21(25-20)24-12-15-9-10-18(16-7-4-3-5-8-16)19(11-15)22-26-28-29-27-22/h3-5,7-11,13,30H,2,6,12,14H2,1H3,(H,23,24,25)(H,26,27,28,29) |
| InChIKey | ANOHXTLPZBLPMX-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |