C18H24N4O3 — CID 178100026
2-butoxy-4-[[4-(dimethylamino)phenyl]methylamino]pyrimidine-5-carboxylic acid (PubChem CID 178100026) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-butoxy-4-[[4-(dimethylamino)phenyl]methylamino]pyrimidine-5-carboxylic acid.
| Compound Name | 2-butoxy-4-[[4-(dimethylamino)phenyl]methylamino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 178100026 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-butoxy-4-[[4-(dimethylamino)phenyl]methylamino]pyrimidine-5-carboxylic acid |
| SMILES | CCCCOc1ncc(C(=O)O)c(NCc2ccc(N(C)C)cc2)n1 |
| InChI | InChI=1S/C18H24N4O3/c1-4-5-10-25-18-20-12-15(17(23)24)16(21-18)19-11-13-6-8-14(9-7-13)22(2)3/h6-9,12H,4-5,10-11H2,1-3H3,(H,23,24)(H,19,20,21) |
| InChIKey | PZEMRESZEOWHGO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|