C14H16N4O4S — CID 72899482
4-[[4-(dimethylsulfamoyl)phenyl]methylamino]pyrimidine-5-carboxylic acid (PubChem CID 72899482) has the molecular formula C14H16N4O4S and a molecular weight of 336.37 g/mol. Its IUPAC name is 4-[[4-(dimethylsulfamoyl)phenyl]methylamino]pyrimidine-5-carboxylic acid.
| Compound Name | 4-[[4-(dimethylsulfamoyl)phenyl]methylamino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 72899482 |
| Molecular Formula | C14H16N4O4S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 4-[[4-(dimethylsulfamoyl)phenyl]methylamino]pyrimidine-5-carboxylic acid |
| SMILES | CN(C)S(=O)(=O)c1ccc(CNc2ncncc2C(=O)O)cc1 |
| InChI | InChI=1S/C14H16N4O4S/c1-18(2)23(21,22)11-5-3-10(4-6-11)7-16-13-12(14(19)20)8-15-9-17-13/h3-6,8-9H,7H2,1-2H3,(H,19,20)(H,15,16,17) |
| InChIKey | HVZHLNZYUQJDTP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |