C16H18N6O2 — CID 82555861
2-amino-6-[[4-(dimethylamino)phenyl]methylamino]-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid (PubChem CID 82555861) has the molecular formula C16H18N6O2 and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-amino-6-[[4-(dimethylamino)phenyl]methylamino]-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid.
| Compound Name | 2-amino-6-[[4-(dimethylamino)phenyl]methylamino]-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid |
|---|---|
| PubChem CID | 82555861 |
| Molecular Formula | C16H18N6O2 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-amino-6-[[4-(dimethylamino)phenyl]methylamino]-[1,2,4]triazolo[1,5-a]pyridine-8-carboxylic acid |
| SMILES | CN(C)c1ccc(CNc2cc(C(=O)O)c3nc(N)nn3c2)cc1 |
| InChI | InChI=1S/C16H18N6O2/c1-21(2)12-5-3-10(4-6-12)8-18-11-7-13(15(23)24)14-19-16(17)20-22(14)9-11/h3-7,9,18H,8H2,1-2H3,(H2,17,20)(H,23,24) |
| InChIKey | ABABHWHHOSGZSF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 108.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|