C18H29N2O4+ — CID 178103006
tert-butyl (4S)-2-[hydroxy-(4-methoxy-3-pyridinyl)methyl]-1,4-dimethylpyrrolidin-1-ium-1-carboxylate (PubChem CID 178103006) has the molecular formula C18H29N2O4+ and a molecular weight of 337.44 g/mol. Its IUPAC name is tert-butyl (4S)-2-[hydroxy-(4-methoxy-3-pyridinyl)methyl]-1,4-dimethylpyrrolidin-1-ium-1-carboxylate.
| Compound Name | tert-butyl (4S)-2-[hydroxy-(4-methoxy-3-pyridinyl)methyl]-1,4-dimethylpyrrolidin-1-ium-1-carboxylate |
|---|---|
| PubChem CID | 178103006 |
| Molecular Formula | C18H29N2O4+ |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.21 |
| IUPAC Name | tert-butyl (4S)-2-[hydroxy-(4-methoxy-3-pyridinyl)methyl]-1,4-dimethylpyrrolidin-1-ium-1-carboxylate |
| SMILES | COc1ccncc1C(O)C1C[C@H](C)C[N+]1(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H29N2O4/c1-12-9-14(16(21)13-10-19-8-7-15(13)23-6)20(5,11-12)17(22)24-18(2,3)4/h7-8,10,12,14,16,21H,9,11H2,1-6H3/q+1/t12-,14?,16?,20?/m0/s1 |
| InChIKey | QGBOSEWJGMDCTB-RGUPYVNJSA-N |
| XLogP | 2.91 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|