C23H26N6O4 — CID 178104004
6-(cyclopropanecarbonylamino)-4-[3-[3-[methyl(prop-2-enoyl)amino]cyclobutyl]oxyanilino]pyridazine-3-carboxamide (PubChem CID 178104004) has the molecular formula C23H26N6O4 and a molecular weight of 450.50 g/mol. Its IUPAC name is 6-(cyclopropanecarbonylamino)-4-[3-[3-[methyl(prop-2-enoyl)amino]cyclobutyl]oxyanilino]pyridazine-3-carboxamide.
| Compound Name | 6-(cyclopropanecarbonylamino)-4-[3-[3-[methyl(prop-2-enoyl)amino]cyclobutyl]oxyanilino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 178104004 |
| Molecular Formula | C23H26N6O4 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | 6-(cyclopropanecarbonylamino)-4-[3-[3-[methyl(prop-2-enoyl)amino]cyclobutyl]oxyanilino]pyridazine-3-carboxamide |
| SMILES | C=CC(=O)N(C)C1CC(Oc2cccc(Nc3cc(NC(=O)C4CC4)nnc3C(N)=O)c2)C1 |
| InChI | InChI=1S/C23H26N6O4/c1-3-20(30)29(2)15-10-17(11-15)33-16-6-4-5-14(9-16)25-18-12-19(26-23(32)13-7-8-13)27-28-21(18)22(24)31/h3-6,9,12-13,15,17H,1,7-8,10-11H2,2H3,(H2,24,31)(H2,25,26,27,32) |
| InChIKey | PWGGGGNMSVKKQM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|