C22H24N6O5 — CID 178104044
6-(cyclopropanecarbonylamino)-4-[2-methoxy-3-(1-prop-2-enoylazetidin-3-yl)oxyanilino]pyridazine-3-carboxamide (PubChem CID 178104044) has the molecular formula C22H24N6O5 and a molecular weight of 452.47 g/mol. Its IUPAC name is 6-(cyclopropanecarbonylamino)-4-[2-methoxy-3-(1-prop-2-enoylazetidin-3-yl)oxyanilino]pyridazine-3-carboxamide.
| Compound Name | 6-(cyclopropanecarbonylamino)-4-[2-methoxy-3-(1-prop-2-enoylazetidin-3-yl)oxyanilino]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 178104044 |
| Molecular Formula | C22H24N6O5 |
| Molecular Weight | 452.47 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 6-(cyclopropanecarbonylamino)-4-[2-methoxy-3-(1-prop-2-enoylazetidin-3-yl)oxyanilino]pyridazine-3-carboxamide |
| SMILES | C=CC(=O)N1CC(Oc2cccc(Nc3cc(NC(=O)C4CC4)nnc3C(N)=O)c2OC)C1 |
| InChI | InChI=1S/C22H24N6O5/c1-3-18(29)28-10-13(11-28)33-16-6-4-5-14(20(16)32-2)24-15-9-17(25-22(31)12-7-8-12)26-27-19(15)21(23)30/h3-6,9,12-13H,1,7-8,10-11H2,2H3,(H2,23,30)(H2,24,25,26,31) |
| InChIKey | JAUASZAZCZUNRW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 148.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.47 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|