C31H49NO — CID 178104601
N-[7-benzyl-2-(3,3-dimethylpentyl)-7-methylnonyl]-4-methoxyaniline (PubChem CID 178104601) has the molecular formula C31H49NO and a molecular weight of 451.74 g/mol. Its IUPAC name is N-[7-benzyl-2-(3,3-dimethylpentyl)-7-methylnonyl]-4-methoxyaniline.
| Compound Name | N-[7-benzyl-2-(3,3-dimethylpentyl)-7-methylnonyl]-4-methoxyaniline |
|---|---|
| PubChem CID | 178104601 |
| Molecular Formula | C31H49NO |
| Molecular Weight | 451.74 g/mol |
| Exact Mass | 451.38 |
| IUPAC Name | N-[7-benzyl-2-(3,3-dimethylpentyl)-7-methylnonyl]-4-methoxyaniline |
| SMILES | CCC(C)(C)CCC(CCCCC(C)(CC)Cc1ccccc1)CNc1ccc(OC)cc1 |
| InChI | InChI=1S/C31H49NO/c1-7-30(3,4)23-21-27(25-32-28-17-19-29(33-6)20-18-28)16-12-13-22-31(5,8-2)24-26-14-10-9-11-15-26/h9-11,14-15,17-20,27,32H,7-8,12-13,16,21-25H2,1-6H3 |
| InChIKey | BDADLAPTCFAJEZ-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.74 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|