C34H43B2N9O2S — CID 178106545
CID 178106545 (PubChem CID 178106545) has the molecular formula C34H43B2N9O2S and a molecular weight of 663.47 g/mol.
| Compound Name | CID 178106545 |
|---|---|
| PubChem CID | 178106545 |
| Molecular Formula | C34H43B2N9O2S |
| Molecular Weight | 663.47 g/mol |
| Exact Mass | 663.34 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)N1CCCC1Cn1nc2c3c(nc(-c4noc(-c5c(CCC)sc(N)c5C#N)c4CCCC)nc31)N1CC(C)CC[C@@H]1CC2 |
| InChI | InChI=1S/C34H43B2N9O2S/c1-4-6-10-22-28(42-47-29(22)26-23(16-37)30(38)48-25(26)8-5-2)31-39-32-27-24(14-13-20-12-11-19(3)17-43(20)32)41-45(33(27)40-31)18-21-9-7-15-44(21)34(35,36)46/h19-21,46H,4-15,17-18,38H2,1-3H3/t19?,20-,21?/m1/s1 |
| InChIKey | RKUJVJPFSXAXHV-NYLDSWQDSA-N |
| XLogP | 4.91 |
| TPSA | 146.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.47 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|