C64H62 — CID 178110343
1,3-ditert-butyl-5-[1-(9,9-dimethylfluoren-2-yl)-3-(4-phenylphenyl)butan-2-yl]-9,9-diphenylfluorene (PubChem CID 178110343) has the molecular formula C64H62 and a molecular weight of 831.20 g/mol. Its IUPAC name is 1,3-ditert-butyl-5-[1-(9,9-dimethylfluoren-2-yl)-3-(4-phenylphenyl)butan-2-yl]-9,9-diphenylfluorene.
| Compound Name | 1,3-ditert-butyl-5-[1-(9,9-dimethylfluoren-2-yl)-3-(4-phenylphenyl)butan-2-yl]-9,9-diphenylfluorene |
|---|---|
| PubChem CID | 178110343 |
| Molecular Formula | C64H62 |
| Molecular Weight | 831.20 g/mol |
| Exact Mass | 830.49 |
| IUPAC Name | 1,3-ditert-butyl-5-[1-(9,9-dimethylfluoren-2-yl)-3-(4-phenylphenyl)butan-2-yl]-9,9-diphenylfluorene |
| SMILES | CC(c1ccc(-c2ccccc2)cc1)C(Cc1ccc2c(c1)C(C)(C)c1ccccc1-2)c1cccc2c1-c1cc(C(C)(C)C)cc(C(C)(C)C)c1C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C64H62/c1-42(44-33-35-46(36-34-44)45-22-13-10-14-23-45)53(38-43-32-37-51-50-28-19-20-30-55(50)63(8,9)57(51)39-43)52-29-21-31-56-59(52)54-40-49(61(2,3)4)41-58(62(5,6)7)60(54)64(56,47-24-15-11-16-25-47)48-26-17-12-18-27-48/h10-37,39-42,53H,38H2,1-9H3 |
| InChIKey | OCFDIVLAPOKNIS-UHFFFAOYSA-N |
| XLogP | 16.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.20 |
| LogP ≤ 5 | 16.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |